C11H10Cl3N5O — CID 64547327
3,4,5-trichloro-N-[3-(1H-1,2,4-triazol-5-yl)propyl]pyridine-2-carboxamide (PubChem CID 64547327) has the molecular formula C11H10Cl3N5O and a molecular weight of 334.59 g/mol. Its IUPAC name is 3,4,5-trichloro-N-[3-(1H-1,2,4-triazol-5-yl)propyl]pyridine-2-carboxamide.
| Compound Name | 3,4,5-trichloro-N-[3-(1H-1,2,4-triazol-5-yl)propyl]pyridine-2-carboxamide |
|---|---|
| PubChem CID | 64547327 |
| Molecular Formula | C11H10Cl3N5O |
| Molecular Weight | 334.59 g/mol |
| Exact Mass | 333.00 |
| IUPAC Name | 3,4,5-trichloro-N-[3-(1H-1,2,4-triazol-5-yl)propyl]pyridine-2-carboxamide |
| SMILES | O=C(NCCCc1ncn[nH]1)c1ncc(Cl)c(Cl)c1Cl |
| InChI | InChI=1S/C11H10Cl3N5O/c12-6-4-16-10(9(14)8(6)13)11(20)15-3-1-2-7-17-5-18-19-7/h4-5H,1-3H2,(H,15,20)(H,17,18,19) |
| InChIKey | OLNCSGKTLMDQOM-UHFFFAOYSA-N |
| XLogP | 2.52 |
| TPSA | 83.56 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 334.59 |
| LogP ≤ 5 | 2.52 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|