C12H13Cl2N5O — CID 64529659
1-(3,4-dichlorophenyl)-3-[3-(1H-1,2,4-triazol-5-yl)propyl]urea (PubChem CID 64529659) has the molecular formula C12H13Cl2N5O and a molecular weight of 314.18 g/mol. Its IUPAC name is 1-(3,4-dichlorophenyl)-3-[3-(1H-1,2,4-triazol-5-yl)propyl]urea.
| Compound Name | 1-(3,4-dichlorophenyl)-3-[3-(1H-1,2,4-triazol-5-yl)propyl]urea |
|---|---|
| PubChem CID | 64529659 |
| Molecular Formula | C12H13Cl2N5O |
| Molecular Weight | 314.18 g/mol |
| Exact Mass | 313.05 |
| IUPAC Name | 1-(3,4-dichlorophenyl)-3-[3-(1H-1,2,4-triazol-5-yl)propyl]urea |
| SMILES | O=C(NCCCc1ncn[nH]1)Nc1ccc(Cl)c(Cl)c1 |
| InChI | InChI=1S/C12H13Cl2N5O/c13-9-4-3-8(6-10(9)14)18-12(20)15-5-1-2-11-16-7-17-19-11/h3-4,6-7H,1-2,5H2,(H2,15,18,20)(H,16,17,19) |
| InChIKey | MPOKZMNZCXZEMI-UHFFFAOYSA-N |
| XLogP | 2.87 |
| TPSA | 82.70 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 314.18 |
| LogP ≤ 5 | 2.87 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|