C18H18Cl4N4O2 — CID 15270622
1-(3,4-dichlorophenyl)-3-[4-[(3,4-dichlorophenyl)carbamoylamino]butyl]urea (PubChem CID 15270622) has the molecular formula C18H18Cl4N4O2 and a molecular weight of 464.18 g/mol. Its IUPAC name is 1-(3,4-dichlorophenyl)-3-[4-[(3,4-dichlorophenyl)carbamoylamino]butyl]urea.
| Compound Name | 1-(3,4-dichlorophenyl)-3-[4-[(3,4-dichlorophenyl)carbamoylamino]butyl]urea |
|---|---|
| PubChem CID | 15270622 |
| Molecular Formula | C18H18Cl4N4O2 |
| Molecular Weight | 464.18 g/mol |
| Exact Mass | 462.02 |
| IUPAC Name | 1-(3,4-dichlorophenyl)-3-[4-[(3,4-dichlorophenyl)carbamoylamino]butyl]urea |
| SMILES | O=C(NCCCCNC(=O)Nc1ccc(Cl)c(Cl)c1)Nc1ccc(Cl)c(Cl)c1 |
| InChI | InChI=1S/C18H18Cl4N4O2/c19-13-5-3-11(9-15(13)21)25-17(27)23-7-1-2-8-24-18(28)26-12-4-6-14(20)16(22)10-12/h3-6,9-10H,1-2,7-8H2,(H2,23,25,27)(H2,24,26,28) |
| InChIKey | NHMMKSXQPVTRRJ-UHFFFAOYSA-N |
| XLogP | 6.02 |
| TPSA | 82.26 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 28 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 464.18 |
| LogP ≤ 5 | 6.02 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|