methyl 3-[(3,4-dichlorophenyl)carbamoylamino]propanoate

C11H12Cl2N2O3 — CID 3810392

IUPACmethyl 3-[(3,4-dichlorophenyl)carbamoylamino]propanoate
SMILESCOC(=O)CCNC(=O)Nc1ccc(Cl)c(Cl)c1
InChIInChI=1S/C11H12Cl2N2O3/c1-18-10(16)4-5-14-11(17)15-7-2-3-8(12)9(13)6-7/h2-3,6H,4-5H2,1H3,(H2,14,15,17)
InChIKeyMEAYPRBEEWDIDG-UHFFFAOYSA-N
MW291.13 g/mol
LogP2.68
Rot. Bonds4

About methyl 3-[(3,4-dichlorophenyl)carbamoylamino]propanoate

methyl 3-[(3,4-dichlorophenyl)carbamoylamino]propanoate (PubChem CID 3810392) has the molecular formula C11H12Cl2N2O3 and a molecular weight of 291.13 g/mol. Its IUPAC name is methyl 3-[(3,4-dichlorophenyl)carbamoylamino]propanoate.

Molecular Properties

Compound Namemethyl 3-[(3,4-dichlorophenyl)carbamoylamino]propanoate
PubChem CID3810392
Molecular FormulaC11H12Cl2N2O3
Molecular Weight291.13 g/mol
Exact Mass290.02
IUPAC Namemethyl 3-[(3,4-dichlorophenyl)carbamoylamino]propanoate
SMILESCOC(=O)CCNC(=O)Nc1ccc(Cl)c(Cl)c1
InChIInChI=1S/C11H12Cl2N2O3/c1-18-10(16)4-5-14-11(17)15-7-2-3-8(12)9(13)6-7/h2-3,6H,4-5H2,1H3,(H2,14,15,17)
InChIKeyMEAYPRBEEWDIDG-UHFFFAOYSA-N
XLogP2.68
TPSA67.43 Ų
H-Bond Donors2
H-Bond Acceptors3
Rotatable Bonds4
Heavy Atoms18
Complexity

Lipinski Rule of Five

Passes Rule of Five

RuleValue
MW ≤ 500291.13
LogP ≤ 52.68
H-Bond Donors ≤ 52
H-Bond Acceptors ≤ 103

Analyze methyl 3-[(3,4-dichlorophenyl)carbamoylamino]propanoate with MolForge

Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.

Launch Full Analysis

Frequently Asked Questions

What is the IUPAC name of methyl 3-[(3,4-dichlorophenyl)carbamoylamino]propanoate?
The IUPAC name of methyl 3-[(3,4-dichlorophenyl)carbamoylamino]propanoate (CID 3810392) is methyl 3-[(3,4-dichlorophenyl)carbamoylamino]propanoate.
What is the SMILES notation for methyl 3-[(3,4-dichlorophenyl)carbamoylamino]propanoate?
The canonical SMILES for methyl 3-[(3,4-dichlorophenyl)carbamoylamino]propanoate is COC(=O)CCNC(=O)Nc1ccc(Cl)c(Cl)c1.
What is the InChIKey of methyl 3-[(3,4-dichlorophenyl)carbamoylamino]propanoate?
The InChIKey is MEAYPRBEEWDIDG-UHFFFAOYSA-N. The full InChI is InChI=1S/C11H12Cl2N2O3/c1-18-10(16)4-5-14-11(17)15-7-2-3-8(12)9(13)6-7/h2-3,6H,4-5H2,1H3,(H2,14,15,17).
What are the key properties of methyl 3-[(3,4-dichlorophenyl)carbamoylamino]propanoate?
methyl 3-[(3,4-dichlorophenyl)carbamoylamino]propanoate has a molecular weight of 291.13 g/mol, XLogP of 2.68, 4 rotatable bonds, 2 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for methyl 3-[(3,4-dichlorophenyl)carbamoylamino]propanoate is sourced from PubChem (CID 3810392), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).