C12H13ClN2O5 — CID 61301290
2-chloro-5-[(3-methoxy-3-oxopropyl)carbamoylamino]benzoic acid (PubChem CID 61301290) has the molecular formula C12H13ClN2O5 and a molecular weight of 300.70 g/mol. Its IUPAC name is 2-chloro-5-[(3-methoxy-3-oxopropyl)carbamoylamino]benzoic acid.
| Compound Name | 2-chloro-5-[(3-methoxy-3-oxopropyl)carbamoylamino]benzoic acid |
|---|---|
| PubChem CID | 61301290 |
| Molecular Formula | C12H13ClN2O5 |
| Molecular Weight | 300.70 g/mol |
| Exact Mass | 300.05 |
| IUPAC Name | 2-chloro-5-[(3-methoxy-3-oxopropyl)carbamoylamino]benzoic acid |
| SMILES | COC(=O)CCNC(=O)Nc1ccc(Cl)c(C(=O)O)c1 |
| InChI | InChI=1S/C12H13ClN2O5/c1-20-10(16)4-5-14-12(19)15-7-2-3-9(13)8(6-7)11(17)18/h2-3,6H,4-5H2,1H3,(H,17,18)(H2,14,15,19) |
| InChIKey | FQTKGSHVZHHSJK-UHFFFAOYSA-N |
| XLogP | 1.72 |
| TPSA | 104.73 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 300.70 |
| LogP ≤ 5 | 1.72 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 4 |