C17H16Cl4N4O2 — CID 4159166
1-(3,4-dichlorophenyl)-3-[3-[(3,4-dichlorophenyl)carbamoylamino]propyl]urea (PubChem CID 4159166) has the molecular formula C17H16Cl4N4O2 and a molecular weight of 450.15 g/mol. Its IUPAC name is 1-(3,4-dichlorophenyl)-3-[3-[(3,4-dichlorophenyl)carbamoylamino]propyl]urea.
| Compound Name | 1-(3,4-dichlorophenyl)-3-[3-[(3,4-dichlorophenyl)carbamoylamino]propyl]urea |
|---|---|
| PubChem CID | 4159166 |
| Molecular Formula | C17H16Cl4N4O2 |
| Molecular Weight | 450.15 g/mol |
| Exact Mass | 448.00 |
| IUPAC Name | 1-(3,4-dichlorophenyl)-3-[3-[(3,4-dichlorophenyl)carbamoylamino]propyl]urea |
| SMILES | O=C(NCCCNC(=O)Nc1ccc(Cl)c(Cl)c1)Nc1ccc(Cl)c(Cl)c1 |
| InChI | InChI=1S/C17H16Cl4N4O2/c18-12-4-2-10(8-14(12)20)24-16(26)22-6-1-7-23-17(27)25-11-3-5-13(19)15(21)9-11/h2-5,8-9H,1,6-7H2,(H2,22,24,26)(H2,23,25,27) |
| InChIKey | FCNHHOGHOMOTCD-UHFFFAOYSA-N |
| XLogP | 5.63 |
| TPSA | 82.26 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 27 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 450.15 |
| LogP ≤ 5 | 5.63 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|