C13H14Cl2N2O — CID 103757513
1-(3,4-dichlorophenyl)-3-hex-5-ynylurea (PubChem CID 103757513) has the molecular formula C13H14Cl2N2O and a molecular weight of 285.17 g/mol. Its IUPAC name is 1-(3,4-dichlorophenyl)-3-hex-5-ynylurea.
| Compound Name | 1-(3,4-dichlorophenyl)-3-hex-5-ynylurea |
|---|---|
| PubChem CID | 103757513 |
| Molecular Formula | C13H14Cl2N2O |
| Molecular Weight | 285.17 g/mol |
| Exact Mass | 284.05 |
| IUPAC Name | 1-(3,4-dichlorophenyl)-3-hex-5-ynylurea |
| SMILES | C#CCCCCNC(=O)Nc1ccc(Cl)c(Cl)c1 |
| InChI | InChI=1S/C13H14Cl2N2O/c1-2-3-4-5-8-16-13(18)17-10-6-7-11(14)12(15)9-10/h1,6-7,9H,3-5,8H2,(H2,16,17,18) |
| InChIKey | PMNBTQOFZLSJAC-UHFFFAOYSA-N |
| XLogP | 3.92 |
| TPSA | 41.13 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 285.17 |
| LogP ≤ 5 | 3.92 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|