C12H12Cl2N2O — CID 103709982
1-(3,5-dichlorophenyl)-3-pent-4-ynylurea (PubChem CID 103709982) has the molecular formula C12H12Cl2N2O and a molecular weight of 271.15 g/mol. Its IUPAC name is 1-(3,5-dichlorophenyl)-3-pent-4-ynylurea.
| Compound Name | 1-(3,5-dichlorophenyl)-3-pent-4-ynylurea |
|---|---|
| PubChem CID | 103709982 |
| Molecular Formula | C12H12Cl2N2O |
| Molecular Weight | 271.15 g/mol |
| Exact Mass | 270.03 |
| IUPAC Name | 1-(3,5-dichlorophenyl)-3-pent-4-ynylurea |
| SMILES | C#CCCCNC(=O)Nc1cc(Cl)cc(Cl)c1 |
| InChI | InChI=1S/C12H12Cl2N2O/c1-2-3-4-5-15-12(17)16-11-7-9(13)6-10(14)8-11/h1,6-8H,3-5H2,(H2,15,16,17) |
| InChIKey | OAFUEZIQYOTNHA-UHFFFAOYSA-N |
| XLogP | 3.53 |
| TPSA | 41.13 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 271.15 |
| LogP ≤ 5 | 3.53 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|