C10H11Cl2N3O2 — CID 56814254
3-[(3,5-dichlorophenyl)carbamoylamino]propanamide (PubChem CID 56814254) has the molecular formula C10H11Cl2N3O2 and a molecular weight of 276.12 g/mol. Its IUPAC name is 3-[(3,5-dichlorophenyl)carbamoylamino]propanamide.
| Compound Name | 3-[(3,5-dichlorophenyl)carbamoylamino]propanamide |
|---|---|
| PubChem CID | 56814254 |
| Molecular Formula | C10H11Cl2N3O2 |
| Molecular Weight | 276.12 g/mol |
| Exact Mass | 275.02 |
| IUPAC Name | 3-[(3,5-dichlorophenyl)carbamoylamino]propanamide |
| SMILES | NC(=O)CCNC(=O)Nc1cc(Cl)cc(Cl)c1 |
| InChI | InChI=1S/C10H11Cl2N3O2/c11-6-3-7(12)5-8(4-6)15-10(17)14-2-1-9(13)16/h3-5H,1-2H2,(H2,13,16)(H2,14,15,17) |
| InChIKey | KFAHEHMJDAMALQ-UHFFFAOYSA-N |
| XLogP | 1.99 |
| TPSA | 84.22 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 276.12 |
| LogP ≤ 5 | 1.99 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 2 |