C13H16Cl2N2O2 — CID 103769234
1-(3,5-dichlorophenyl)-3-[2-(2-methylprop-2-enoxy)ethyl]urea (PubChem CID 103769234) has the molecular formula C13H16Cl2N2O2 and a molecular weight of 303.19 g/mol. Its IUPAC name is 1-(3,5-dichlorophenyl)-3-[2-(2-methylprop-2-enoxy)ethyl]urea.
| Compound Name | 1-(3,5-dichlorophenyl)-3-[2-(2-methylprop-2-enoxy)ethyl]urea |
|---|---|
| PubChem CID | 103769234 |
| Molecular Formula | C13H16Cl2N2O2 |
| Molecular Weight | 303.19 g/mol |
| Exact Mass | 302.06 |
| IUPAC Name | 1-(3,5-dichlorophenyl)-3-[2-(2-methylprop-2-enoxy)ethyl]urea |
| SMILES | C=C(C)COCCNC(=O)Nc1cc(Cl)cc(Cl)c1 |
| InChI | InChI=1S/C13H16Cl2N2O2/c1-9(2)8-19-4-3-16-13(18)17-12-6-10(14)5-11(15)7-12/h5-7H,1,3-4,8H2,2H3,(H2,16,17,18) |
| InChIKey | YAFOWBDUQWQOFR-UHFFFAOYSA-N |
| XLogP | 3.71 |
| TPSA | 50.36 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 303.19 |
| LogP ≤ 5 | 3.71 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|