C10H10Cl2N2O3 — CID 28511134
3-[(3,5-dichlorophenyl)carbamoylamino]propanoic acid (PubChem CID 28511134) has the molecular formula C10H10Cl2N2O3 and a molecular weight of 277.11 g/mol. Its IUPAC name is 3-[(3,5-dichlorophenyl)carbamoylamino]propanoic acid.
| Compound Name | 3-[(3,5-dichlorophenyl)carbamoylamino]propanoic acid |
|---|---|
| PubChem CID | 28511134 |
| Molecular Formula | C10H10Cl2N2O3 |
| Molecular Weight | 277.11 g/mol |
| Exact Mass | 276.01 |
| IUPAC Name | 3-[(3,5-dichlorophenyl)carbamoylamino]propanoic acid |
| SMILES | O=C(O)CCNC(=O)Nc1cc(Cl)cc(Cl)c1 |
| InChI | InChI=1S/C10H10Cl2N2O3/c11-6-3-7(12)5-8(4-6)14-10(17)13-2-1-9(15)16/h3-5H,1-2H2,(H,15,16)(H2,13,14,17) |
| InChIKey | HDMLJPGCWZFZTE-UHFFFAOYSA-N |
| XLogP | 2.59 |
| TPSA | 78.43 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 277.11 |
| LogP ≤ 5 | 2.59 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 2 |