C11H14ClN3OS — CID 62668290
1-(4-amino-4-sulfanylidenebutyl)-3-(3-chlorophenyl)urea (PubChem CID 62668290) has the molecular formula C11H14ClN3OS and a molecular weight of 271.77 g/mol. Its IUPAC name is 1-(4-amino-4-sulfanylidenebutyl)-3-(3-chlorophenyl)urea.
| Compound Name | 1-(4-amino-4-sulfanylidenebutyl)-3-(3-chlorophenyl)urea |
|---|---|
| PubChem CID | 62668290 |
| Molecular Formula | C11H14ClN3OS |
| Molecular Weight | 271.77 g/mol |
| Exact Mass | 271.05 |
| IUPAC Name | 1-(4-amino-4-sulfanylidenebutyl)-3-(3-chlorophenyl)urea |
| SMILES | NC(=S)CCCNC(=O)Nc1cccc(Cl)c1 |
| InChI | InChI=1S/C11H14ClN3OS/c12-8-3-1-4-9(7-8)15-11(16)14-6-2-5-10(13)17/h1,3-4,7H,2,5-6H2,(H2,13,17)(H2,14,15,16) |
| InChIKey | AEFNODOOQNJSJV-UHFFFAOYSA-N |
| XLogP | 2.53 |
| TPSA | 67.15 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 271.77 |
| LogP ≤ 5 | 2.53 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|