C15H24ClN3O — CID 110446856
1-(3-chlorophenyl)-3-[4-(diethylamino)butyl]urea (PubChem CID 110446856) has the molecular formula C15H24ClN3O and a molecular weight of 297.83 g/mol. Its IUPAC name is 1-(3-chlorophenyl)-3-[4-(diethylamino)butyl]urea.
| Compound Name | 1-(3-chlorophenyl)-3-[4-(diethylamino)butyl]urea |
|---|---|
| PubChem CID | 110446856 |
| Molecular Formula | C15H24ClN3O |
| Molecular Weight | 297.83 g/mol |
| Exact Mass | 297.16 |
| IUPAC Name | 1-(3-chlorophenyl)-3-[4-(diethylamino)butyl]urea |
| SMILES | CCN(CC)CCCCNC(=O)Nc1cccc(Cl)c1 |
| InChI | InChI=1S/C15H24ClN3O/c1-3-19(4-2)11-6-5-10-17-15(20)18-14-9-7-8-13(16)12-14/h7-9,12H,3-6,10-11H2,1-2H3,(H2,17,18,20) |
| InChIKey | QMLPHLVDFOQMDY-UHFFFAOYSA-N |
| XLogP | 3.58 |
| TPSA | 44.37 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 297.83 |
| LogP ≤ 5 | 3.58 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|