C25H34Cl2N4O2 — CID 27255107
1-(3-chlorophenyl)-3-[(4S)-4-[[(3-chlorophenyl)carbamoylamino]methyl]-4-ethyloctyl]urea (PubChem CID 27255107) has the molecular formula C25H34Cl2N4O2 and a molecular weight of 493.48 g/mol. Its IUPAC name is 1-(3-chlorophenyl)-3-[(4S)-4-[[(3-chlorophenyl)carbamoylamino]methyl]-4-ethyloctyl]urea.
| Compound Name | 1-(3-chlorophenyl)-3-[(4S)-4-[[(3-chlorophenyl)carbamoylamino]methyl]-4-ethyloctyl]urea |
|---|---|
| PubChem CID | 27255107 |
| Molecular Formula | C25H34Cl2N4O2 |
| Molecular Weight | 493.48 g/mol |
| Exact Mass | 492.21 |
| IUPAC Name | 1-(3-chlorophenyl)-3-[(4S)-4-[[(3-chlorophenyl)carbamoylamino]methyl]-4-ethyloctyl]urea |
| SMILES | CCCC[C@@](CC)(CCCNC(=O)Nc1cccc(Cl)c1)CNC(=O)Nc1cccc(Cl)c1 |
| InChI | InChI=1S/C25H34Cl2N4O2/c1-3-5-13-25(4-2,18-29-24(33)31-22-12-7-10-20(27)17-22)14-8-15-28-23(32)30-21-11-6-9-19(26)16-21/h6-7,9-12,16-17H,3-5,8,13-15,18H2,1-2H3,(H2,28,30,32)(H2,29,31,33)/t25-/m0/s1 |
| InChIKey | PWLIBILEVGDZSV-VWLOTQADSA-N |
| XLogP | 7.30 |
| TPSA | 82.26 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 12 |
| Heavy Atoms | 33 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 493.48 |
| LogP ≤ 5 | 7.30 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|