C15H22ClN3O2Y-2 — CID 59168747
1-(3-chlorophenyl)-3-[2-(oxomethylamino)ethyl]urea;pentane;yttrium (PubChem CID 59168747) has the molecular formula C15H22ClN3O2Y-2 and a molecular weight of 400.72 g/mol. Its IUPAC name is 1-(3-chlorophenyl)-3-[2-(oxomethylamino)ethyl]urea;pentane;yttrium.
| Compound Name | 1-(3-chlorophenyl)-3-[2-(oxomethylamino)ethyl]urea;pentane;yttrium |
|---|---|
| PubChem CID | 59168747 |
| Molecular Formula | C15H22ClN3O2Y-2 |
| Molecular Weight | 400.72 g/mol |
| Exact Mass | 400.05 |
| IUPAC Name | 1-(3-chlorophenyl)-3-[2-(oxomethylamino)ethyl]urea;pentane;yttrium |
| SMILES | O=[C-]NCCNC(=O)Nc1cccc(Cl)c1.[CH2-]CCCC.[Y] |
| InChI | InChI=1S/C10H11ClN3O2.C5H11.Y/c11-8-2-1-3-9(6-8)14-10(16)13-5-4-12-7-15;1-3-5-4-2;/h1-3,6H,4-5H2,(H,12,15)(H2,13,14,16);1,3-5H2,2H3;/q2*-1; |
| InChIKey | GXXMHWGAFAJPJQ-UHFFFAOYSA-N |
| XLogP | 3.13 |
| TPSA | 70.23 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 400.72 |
| LogP ≤ 5 | 3.13 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'Carbo_cation/anion', 'substructure': 'N/A'}, {'alert_name': 'enamine', 'substructure': 'N/A'} |
|---|