C19H32N2O — CID 3697946
1-dodecyl-3-phenylurea (PubChem CID 3697946) has the molecular formula C19H32N2O and a molecular weight of 304.48 g/mol. Its IUPAC name is 1-dodecyl-3-phenylurea.
| Compound Name | 1-dodecyl-3-phenylurea |
|---|---|
| PubChem CID | 3697946 |
| Molecular Formula | C19H32N2O |
| Molecular Weight | 304.48 g/mol |
| Exact Mass | 304.25 |
| IUPAC Name | 1-dodecyl-3-phenylurea |
| SMILES | CCCCCCCCCCCCNC(=O)Nc1ccccc1 |
| InChI | InChI=1S/C19H32N2O/c1-2-3-4-5-6-7-8-9-10-14-17-20-19(22)21-18-15-12-11-13-16-18/h11-13,15-16H,2-10,14,17H2,1H3,(H2,20,21,22) |
| InChIKey | MJNSDXVQSIPSQE-UHFFFAOYSA-N |
| XLogP | 5.73 |
| TPSA | 41.13 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 12 |
| Heavy Atoms | 22 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 304.48 |
| LogP ≤ 5 | 5.73 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|