C16H26N2O — CID 10659432
1-phenyl-3-(2,2,3,3-tetradeuteriononyl)urea (PubChem CID 10659432) has the molecular formula C16H26N2O and a molecular weight of 266.42 g/mol. Its IUPAC name is 1-phenyl-3-(2,2,3,3-tetradeuteriononyl)urea.
| Compound Name | 1-phenyl-3-(2,2,3,3-tetradeuteriononyl)urea |
|---|---|
| PubChem CID | 10659432 |
| Molecular Formula | C16H26N2O |
| Molecular Weight | 266.42 g/mol |
| Exact Mass | 266.23 |
| IUPAC Name | 1-phenyl-3-(2,2,3,3-tetradeuteriononyl)urea |
| SMILES | [2H]C([2H])(CCCCCC)C([2H])([2H])CNC(=O)Nc1ccccc1 |
| InChI | InChI=1S/C16H26N2O/c1-2-3-4-5-6-7-11-14-17-16(19)18-15-12-9-8-10-13-15/h8-10,12-13H,2-7,11,14H2,1H3,(H2,17,18,19)/i7D2,11D2 |
| InChIKey | CYEAILAUJANBMT-HTIMLBFPSA-N |
| XLogP | 4.56 |
| TPSA | 41.13 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 266.42 |
| LogP ≤ 5 | 4.56 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|