About 1-ethyl-3-phenylurea;N-ethylpropan-1-amine
1-ethyl-3-phenylurea;N-ethylpropan-1-amine (PubChem CID 70474820) has the molecular formula C14H25N3O
and a molecular weight of 251.37 g/mol. Its IUPAC name is 1-ethyl-3-phenylurea;N-ethylpropan-1-amine.
Molecular Properties
| Compound Name | 1-ethyl-3-phenylurea;N-ethylpropan-1-amine |
| PubChem CID | 70474820 |
| Molecular Formula | C14H25N3O |
| Molecular Weight | 251.37 g/mol |
| Exact Mass | 251.20 |
| IUPAC Name | 1-ethyl-3-phenylurea;N-ethylpropan-1-amine |
| SMILES | CCCNCC.CCNC(=O)Nc1ccccc1 |
| InChI | InChI=1S/C9H12N2O.C5H13N/c1-2-10-9(12)11-8-6-4-3-5-7-8;1-3-5-6-4-2/h3-7H,2H2,1H3,(H2,10,11,12);6H,3-5H2,1-2H3 |
| InChIKey | TWDFFPUQCPOCKH-UHFFFAOYSA-N |
| XLogP | 2.83 |
| TPSA | 53.16 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 18 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 251.37 |
| LogP ≤ 5 | 2.83 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 2 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|
Analyze 1-ethyl-3-phenylurea;N-ethylpropan-1-amine with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 1-ethyl-3-phenylurea;N-ethylpropan-1-amine?
The IUPAC name of 1-ethyl-3-phenylurea;N-ethylpropan-1-amine (CID 70474820) is 1-ethyl-3-phenylurea;N-ethylpropan-1-amine.
What is the SMILES notation for 1-ethyl-3-phenylurea;N-ethylpropan-1-amine?
The canonical SMILES for 1-ethyl-3-phenylurea;N-ethylpropan-1-amine is CCCNCC.CCNC(=O)Nc1ccccc1.
What is the InChIKey of 1-ethyl-3-phenylurea;N-ethylpropan-1-amine?
The InChIKey is TWDFFPUQCPOCKH-UHFFFAOYSA-N. The full InChI is InChI=1S/C9H12N2O.C5H13N/c1-2-10-9(12)11-8-6-4-3-5-7-8;1-3-5-6-4-2/h3-7H,2H2,1H3,(H2,10,11,12);6H,3-5H2,1-2H3.
What are the key properties of 1-ethyl-3-phenylurea;N-ethylpropan-1-amine?
1-ethyl-3-phenylurea;N-ethylpropan-1-amine has a molecular weight of 251.37 g/mol, XLogP of 2.83, 5 rotatable bonds, 3 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for 1-ethyl-3-phenylurea;N-ethylpropan-1-amine is sourced from PubChem (CID 70474820), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).