C14H22N4O2 — CID 119506823
N-[2-(ethylamino)ethyl]-2-(phenylcarbamoylamino)propanamide (PubChem CID 119506823) has the molecular formula C14H22N4O2 and a molecular weight of 278.36 g/mol. Its IUPAC name is N-[2-(ethylamino)ethyl]-2-(phenylcarbamoylamino)propanamide.
| Compound Name | N-[2-(ethylamino)ethyl]-2-(phenylcarbamoylamino)propanamide |
|---|---|
| PubChem CID | 119506823 |
| Molecular Formula | C14H22N4O2 |
| Molecular Weight | 278.36 g/mol |
| Exact Mass | 278.17 |
| IUPAC Name | N-[2-(ethylamino)ethyl]-2-(phenylcarbamoylamino)propanamide |
| SMILES | CCNCCNC(=O)C(C)NC(=O)Nc1ccccc1 |
| InChI | InChI=1S/C14H22N4O2/c1-3-15-9-10-16-13(19)11(2)17-14(20)18-12-7-5-4-6-8-12/h4-8,11,15H,3,9-10H2,1-2H3,(H,16,19)(H2,17,18,20) |
| InChIKey | QPCYVLKQWCWLKR-UHFFFAOYSA-N |
| XLogP | 0.92 |
| TPSA | 82.26 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 278.36 |
| LogP ≤ 5 | 0.92 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|