C17H20N4O4 — CID 94441497
(2S)-N-[2-(furan-2-ylmethylamino)-2-oxoethyl]-2-(phenylcarbamoylamino)propanamide (PubChem CID 94441497) has the molecular formula C17H20N4O4 and a molecular weight of 344.37 g/mol. Its IUPAC name is (2S)-N-[2-(furan-2-ylmethylamino)-2-oxoethyl]-2-(phenylcarbamoylamino)propanamide.
| Compound Name | (2S)-N-[2-(furan-2-ylmethylamino)-2-oxoethyl]-2-(phenylcarbamoylamino)propanamide |
|---|---|
| PubChem CID | 94441497 |
| Molecular Formula | C17H20N4O4 |
| Molecular Weight | 344.37 g/mol |
| Exact Mass | 344.15 |
| IUPAC Name | (2S)-N-[2-(furan-2-ylmethylamino)-2-oxoethyl]-2-(phenylcarbamoylamino)propanamide |
| SMILES | C[C@H](NC(=O)Nc1ccccc1)C(=O)NCC(=O)NCc1ccco1 |
| InChI | InChI=1S/C17H20N4O4/c1-12(20-17(24)21-13-6-3-2-4-7-13)16(23)19-11-15(22)18-10-14-8-5-9-25-14/h2-9,12H,10-11H2,1H3,(H,18,22)(H,19,23)(H2,20,21,24)/t12-/m0/s1 |
| InChIKey | LQEAXKUFSVMBBS-LBPRGKRZSA-N |
| XLogP | 1.22 |
| TPSA | 112.47 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 344.37 |
| LogP ≤ 5 | 1.22 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 4 |