C19H23N3O5 — CID 7617199
[2-(furan-2-ylmethylamino)-2-oxoethyl] (2S)-3-methyl-2-(phenylcarbamoylamino)butanoate (PubChem CID 7617199) has the molecular formula C19H23N3O5 and a molecular weight of 373.41 g/mol. Its IUPAC name is [2-(furan-2-ylmethylamino)-2-oxoethyl] (2S)-3-methyl-2-(phenylcarbamoylamino)butanoate.
| Compound Name | [2-(furan-2-ylmethylamino)-2-oxoethyl] (2S)-3-methyl-2-(phenylcarbamoylamino)butanoate |
|---|---|
| PubChem CID | 7617199 |
| Molecular Formula | C19H23N3O5 |
| Molecular Weight | 373.41 g/mol |
| Exact Mass | 373.16 |
| IUPAC Name | [2-(furan-2-ylmethylamino)-2-oxoethyl] (2S)-3-methyl-2-(phenylcarbamoylamino)butanoate |
| SMILES | CC(C)[C@H](NC(=O)Nc1ccccc1)C(=O)OCC(=O)NCc1ccco1 |
| InChI | InChI=1S/C19H23N3O5/c1-13(2)17(22-19(25)21-14-7-4-3-5-8-14)18(24)27-12-16(23)20-11-15-9-6-10-26-15/h3-10,13,17H,11-12H2,1-2H3,(H,20,23)(H2,21,22,25)/t17-/m0/s1 |
| InChIKey | KWRQMVCSFDGQAM-KRWDZBQOSA-N |
| XLogP | 2.29 |
| TPSA | 109.67 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 373.41 |
| LogP ≤ 5 | 2.29 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 5 |