C14H19N3O4 — CID 7617134
(2-amino-2-oxoethyl) (2S)-3-methyl-2-(phenylcarbamoylamino)butanoate (PubChem CID 7617134) has the molecular formula C14H19N3O4 and a molecular weight of 293.32 g/mol. Its IUPAC name is (2-amino-2-oxoethyl) (2S)-3-methyl-2-(phenylcarbamoylamino)butanoate.
| Compound Name | (2-amino-2-oxoethyl) (2S)-3-methyl-2-(phenylcarbamoylamino)butanoate |
|---|---|
| PubChem CID | 7617134 |
| Molecular Formula | C14H19N3O4 |
| Molecular Weight | 293.32 g/mol |
| Exact Mass | 293.14 |
| IUPAC Name | (2-amino-2-oxoethyl) (2S)-3-methyl-2-(phenylcarbamoylamino)butanoate |
| SMILES | CC(C)[C@H](NC(=O)Nc1ccccc1)C(=O)OCC(N)=O |
| InChI | InChI=1S/C14H19N3O4/c1-9(2)12(13(19)21-8-11(15)18)17-14(20)16-10-6-4-3-5-7-10/h3-7,9,12H,8H2,1-2H3,(H2,15,18)(H2,16,17,20)/t12-/m0/s1 |
| InChIKey | KYSOAEUFSVEGMQ-LBPRGKRZSA-N |
| XLogP | 0.86 |
| TPSA | 110.52 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 293.32 |
| LogP ≤ 5 | 0.86 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 4 |