C21H24N4O5 — CID 7617290
[2-(4-carbamoylanilino)-2-oxoethyl] (2R)-3-methyl-2-(phenylcarbamoylamino)butanoate (PubChem CID 7617290) has the molecular formula C21H24N4O5 and a molecular weight of 412.45 g/mol. Its IUPAC name is [2-(4-carbamoylanilino)-2-oxoethyl] (2R)-3-methyl-2-(phenylcarbamoylamino)butanoate.
| Compound Name | [2-(4-carbamoylanilino)-2-oxoethyl] (2R)-3-methyl-2-(phenylcarbamoylamino)butanoate |
|---|---|
| PubChem CID | 7617290 |
| Molecular Formula | C21H24N4O5 |
| Molecular Weight | 412.45 g/mol |
| Exact Mass | 412.17 |
| IUPAC Name | [2-(4-carbamoylanilino)-2-oxoethyl] (2R)-3-methyl-2-(phenylcarbamoylamino)butanoate |
| SMILES | CC(C)[C@@H](NC(=O)Nc1ccccc1)C(=O)OCC(=O)Nc1ccc(C(N)=O)cc1 |
| InChI | InChI=1S/C21H24N4O5/c1-13(2)18(25-21(29)24-15-6-4-3-5-7-15)20(28)30-12-17(26)23-16-10-8-14(9-11-16)19(22)27/h3-11,13,18H,12H2,1-2H3,(H2,22,27)(H,23,26)(H2,24,25,29)/t18-/m1/s1 |
| InChIKey | KFFBSBQJBXBQIR-GOSISDBHSA-N |
| XLogP | 2.11 |
| TPSA | 139.62 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 412.45 |
| LogP ≤ 5 | 2.11 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 5 |