C20H31N3O4 — CID 7616948
[2-[di(propan-2-yl)amino]-2-oxoethyl] (2S)-3-methyl-2-(phenylcarbamoylamino)butanoate (PubChem CID 7616948) has the molecular formula C20H31N3O4 and a molecular weight of 377.49 g/mol. Its IUPAC name is [2-[di(propan-2-yl)amino]-2-oxoethyl] (2S)-3-methyl-2-(phenylcarbamoylamino)butanoate.
| Compound Name | [2-[di(propan-2-yl)amino]-2-oxoethyl] (2S)-3-methyl-2-(phenylcarbamoylamino)butanoate |
|---|---|
| PubChem CID | 7616948 |
| Molecular Formula | C20H31N3O4 |
| Molecular Weight | 377.49 g/mol |
| Exact Mass | 377.23 |
| IUPAC Name | [2-[di(propan-2-yl)amino]-2-oxoethyl] (2S)-3-methyl-2-(phenylcarbamoylamino)butanoate |
| SMILES | CC(C)[C@H](NC(=O)Nc1ccccc1)C(=O)OCC(=O)N(C(C)C)C(C)C |
| InChI | InChI=1S/C20H31N3O4/c1-13(2)18(22-20(26)21-16-10-8-7-9-11-16)19(25)27-12-17(24)23(14(3)4)15(5)6/h7-11,13-15,18H,12H2,1-6H3,(H2,21,22,26)/t18-/m0/s1 |
| InChIKey | HGEJFZMILUXMRO-SFHVURJKSA-N |
| XLogP | 3.02 |
| TPSA | 87.74 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 377.49 |
| LogP ≤ 5 | 3.02 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |