C22H25N3O5 — CID 7617307
[2-(4-acetylanilino)-2-oxoethyl] (2S)-3-methyl-2-(phenylcarbamoylamino)butanoate (PubChem CID 7617307) has the molecular formula C22H25N3O5 and a molecular weight of 411.46 g/mol. Its IUPAC name is [2-(4-acetylanilino)-2-oxoethyl] (2S)-3-methyl-2-(phenylcarbamoylamino)butanoate.
| Compound Name | [2-(4-acetylanilino)-2-oxoethyl] (2S)-3-methyl-2-(phenylcarbamoylamino)butanoate |
|---|---|
| PubChem CID | 7617307 |
| Molecular Formula | C22H25N3O5 |
| Molecular Weight | 411.46 g/mol |
| Exact Mass | 411.18 |
| IUPAC Name | [2-(4-acetylanilino)-2-oxoethyl] (2S)-3-methyl-2-(phenylcarbamoylamino)butanoate |
| SMILES | CC(=O)c1ccc(NC(=O)COC(=O)[C@@H](NC(=O)Nc2ccccc2)C(C)C)cc1 |
| InChI | InChI=1S/C22H25N3O5/c1-14(2)20(25-22(29)24-17-7-5-4-6-8-17)21(28)30-13-19(27)23-18-11-9-16(10-12-18)15(3)26/h4-12,14,20H,13H2,1-3H3,(H,23,27)(H2,24,25,29)/t20-/m0/s1 |
| InChIKey | ZPMISKLTQPGGOY-FQEVSTJZSA-N |
| XLogP | 3.22 |
| TPSA | 113.60 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 411.46 |
| LogP ≤ 5 | 3.22 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 5 |