C20H22N2O6 — CID 8575628
[2-(4-acetylanilino)-2-oxoethyl] (2S)-2-(furan-2-carbonylamino)-3-methylbutanoate (PubChem CID 8575628) has the molecular formula C20H22N2O6 and a molecular weight of 386.40 g/mol. Its IUPAC name is [2-(4-acetylanilino)-2-oxoethyl] (2S)-2-(furan-2-carbonylamino)-3-methylbutanoate.
| Compound Name | [2-(4-acetylanilino)-2-oxoethyl] (2S)-2-(furan-2-carbonylamino)-3-methylbutanoate |
|---|---|
| PubChem CID | 8575628 |
| Molecular Formula | C20H22N2O6 |
| Molecular Weight | 386.40 g/mol |
| Exact Mass | 386.15 |
| IUPAC Name | [2-(4-acetylanilino)-2-oxoethyl] (2S)-2-(furan-2-carbonylamino)-3-methylbutanoate |
| SMILES | CC(=O)c1ccc(NC(=O)COC(=O)[C@@H](NC(=O)c2ccco2)C(C)C)cc1 |
| InChI | InChI=1S/C20H22N2O6/c1-12(2)18(22-19(25)16-5-4-10-27-16)20(26)28-11-17(24)21-15-8-6-14(7-9-15)13(3)23/h4-10,12,18H,11H2,1-3H3,(H,21,24)(H,22,25)/t18-/m0/s1 |
| InChIKey | RQGVKGJPVHGOPQ-SFHVURJKSA-N |
| XLogP | 2.42 |
| TPSA | 114.71 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 386.40 |
| LogP ≤ 5 | 2.42 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |