C20H23N3O6 — CID 55306477
[2-(4-acetamidoanilino)-2-oxoethyl] 2-(furan-2-carbonylamino)-3-methylbutanoate (PubChem CID 55306477) has the molecular formula C20H23N3O6 and a molecular weight of 401.42 g/mol. Its IUPAC name is [2-(4-acetamidoanilino)-2-oxoethyl] 2-(furan-2-carbonylamino)-3-methylbutanoate.
| Compound Name | [2-(4-acetamidoanilino)-2-oxoethyl] 2-(furan-2-carbonylamino)-3-methylbutanoate |
|---|---|
| PubChem CID | 55306477 |
| Molecular Formula | C20H23N3O6 |
| Molecular Weight | 401.42 g/mol |
| Exact Mass | 401.16 |
| IUPAC Name | [2-(4-acetamidoanilino)-2-oxoethyl] 2-(furan-2-carbonylamino)-3-methylbutanoate |
| SMILES | CC(=O)Nc1ccc(NC(=O)COC(=O)C(NC(=O)c2ccco2)C(C)C)cc1 |
| InChI | InChI=1S/C20H23N3O6/c1-12(2)18(23-19(26)16-5-4-10-28-16)20(27)29-11-17(25)22-15-8-6-14(7-9-15)21-13(3)24/h4-10,12,18H,11H2,1-3H3,(H,21,24)(H,22,25)(H,23,26) |
| InChIKey | FWJXEZBHPJJLLI-UHFFFAOYSA-N |
| XLogP | 2.17 |
| TPSA | 126.74 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 401.42 |
| LogP ≤ 5 | 2.17 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 6 |