C17H25N3O6 — CID 2470214
[2-(tert-butylcarbamoylamino)-2-oxoethyl] (2R)-2-(furan-2-carbonylamino)-3-methylbutanoate (PubChem CID 2470214) has the molecular formula C17H25N3O6 and a molecular weight of 367.40 g/mol. Its IUPAC name is [2-(tert-butylcarbamoylamino)-2-oxoethyl] (2R)-2-(furan-2-carbonylamino)-3-methylbutanoate.
| Compound Name | [2-(tert-butylcarbamoylamino)-2-oxoethyl] (2R)-2-(furan-2-carbonylamino)-3-methylbutanoate |
|---|---|
| PubChem CID | 2470214 |
| Molecular Formula | C17H25N3O6 |
| Molecular Weight | 367.40 g/mol |
| Exact Mass | 367.17 |
| IUPAC Name | [2-(tert-butylcarbamoylamino)-2-oxoethyl] (2R)-2-(furan-2-carbonylamino)-3-methylbutanoate |
| SMILES | CC(C)[C@@H](NC(=O)c1ccco1)C(=O)OCC(=O)NC(=O)NC(C)(C)C |
| InChI | InChI=1S/C17H25N3O6/c1-10(2)13(19-14(22)11-7-6-8-25-11)15(23)26-9-12(21)18-16(24)20-17(3,4)5/h6-8,10,13H,9H2,1-5H3,(H,19,22)(H2,18,20,21,24)/t13-/m1/s1 |
| InChIKey | IKRMVJQFMVJZIH-CYBMUJFWSA-N |
| XLogP | 1.20 |
| TPSA | 126.74 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 367.40 |
| LogP ≤ 5 | 1.20 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 6 |