C16H23N3O6 — CID 7566578
[2-oxo-2-(propylcarbamoylamino)ethyl] (2S)-2-(furan-2-carbonylamino)-3-methylbutanoate (PubChem CID 7566578) has the molecular formula C16H23N3O6 and a molecular weight of 353.38 g/mol. Its IUPAC name is [2-oxo-2-(propylcarbamoylamino)ethyl] (2S)-2-(furan-2-carbonylamino)-3-methylbutanoate.
| Compound Name | [2-oxo-2-(propylcarbamoylamino)ethyl] (2S)-2-(furan-2-carbonylamino)-3-methylbutanoate |
|---|---|
| PubChem CID | 7566578 |
| Molecular Formula | C16H23N3O6 |
| Molecular Weight | 353.38 g/mol |
| Exact Mass | 353.16 |
| IUPAC Name | [2-oxo-2-(propylcarbamoylamino)ethyl] (2S)-2-(furan-2-carbonylamino)-3-methylbutanoate |
| SMILES | CCCNC(=O)NC(=O)COC(=O)[C@@H](NC(=O)c1ccco1)C(C)C |
| InChI | InChI=1S/C16H23N3O6/c1-4-7-17-16(23)18-12(20)9-25-15(22)13(10(2)3)19-14(21)11-6-5-8-24-11/h5-6,8,10,13H,4,7,9H2,1-3H3,(H,19,21)(H2,17,18,20,23)/t13-/m0/s1 |
| InChIKey | DQVHNLRQEJIOPG-ZDUSSCGKSA-N |
| XLogP | 0.81 |
| TPSA | 126.74 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 353.38 |
| LogP ≤ 5 | 0.81 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 6 |