C22H33N3O5 — CID 3691714
[2-oxo-2-(propylcarbamoylamino)ethyl] 2-[(4-tert-butylbenzoyl)amino]-3-methylbutanoate (PubChem CID 3691714) has the molecular formula C22H33N3O5 and a molecular weight of 419.52 g/mol. Its IUPAC name is [2-oxo-2-(propylcarbamoylamino)ethyl] 2-[(4-tert-butylbenzoyl)amino]-3-methylbutanoate.
| Compound Name | [2-oxo-2-(propylcarbamoylamino)ethyl] 2-[(4-tert-butylbenzoyl)amino]-3-methylbutanoate |
|---|---|
| PubChem CID | 3691714 |
| Molecular Formula | C22H33N3O5 |
| Molecular Weight | 419.52 g/mol |
| Exact Mass | 419.24 |
| IUPAC Name | [2-oxo-2-(propylcarbamoylamino)ethyl] 2-[(4-tert-butylbenzoyl)amino]-3-methylbutanoate |
| SMILES | CCCNC(=O)NC(=O)COC(=O)C(NC(=O)c1ccc(C(C)(C)C)cc1)C(C)C |
| InChI | InChI=1S/C22H33N3O5/c1-7-12-23-21(29)24-17(26)13-30-20(28)18(14(2)3)25-19(27)15-8-10-16(11-9-15)22(4,5)6/h8-11,14,18H,7,12-13H2,1-6H3,(H,25,27)(H2,23,24,26,29) |
| InChIKey | FJHZYDRVBIVLEQ-UHFFFAOYSA-N |
| XLogP | 2.52 |
| TPSA | 113.60 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 419.52 |
| LogP ≤ 5 | 2.52 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 5 |