C17H23N3O6 — CID 7567179
[2-(carbamoylamino)-2-oxoethyl] (2S)-2-[(4-ethoxybenzoyl)amino]-3-methylbutanoate (PubChem CID 7567179) has the molecular formula C17H23N3O6 and a molecular weight of 365.39 g/mol. Its IUPAC name is [2-(carbamoylamino)-2-oxoethyl] (2S)-2-[(4-ethoxybenzoyl)amino]-3-methylbutanoate.
| Compound Name | [2-(carbamoylamino)-2-oxoethyl] (2S)-2-[(4-ethoxybenzoyl)amino]-3-methylbutanoate |
|---|---|
| PubChem CID | 7567179 |
| Molecular Formula | C17H23N3O6 |
| Molecular Weight | 365.39 g/mol |
| Exact Mass | 365.16 |
| IUPAC Name | [2-(carbamoylamino)-2-oxoethyl] (2S)-2-[(4-ethoxybenzoyl)amino]-3-methylbutanoate |
| SMILES | CCOc1ccc(C(=O)N[C@H](C(=O)OCC(=O)NC(N)=O)C(C)C)cc1 |
| InChI | InChI=1S/C17H23N3O6/c1-4-25-12-7-5-11(6-8-12)15(22)20-14(10(2)3)16(23)26-9-13(21)19-17(18)24/h5-8,10,14H,4,9H2,1-3H3,(H,20,22)(H3,18,19,21,24)/t14-/m0/s1 |
| InChIKey | HRWCOHZTHJYHNY-AWEZNQCLSA-N |
| XLogP | 0.58 |
| TPSA | 136.82 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 365.39 |
| LogP ≤ 5 | 0.58 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 6 |