C24H30N2O5 — CID 55305782
[2-(2-ethylanilino)-2-oxoethyl] 2-[(4-ethoxybenzoyl)amino]-3-methylbutanoate (PubChem CID 55305782) has the molecular formula C24H30N2O5 and a molecular weight of 426.51 g/mol. Its IUPAC name is [2-(2-ethylanilino)-2-oxoethyl] 2-[(4-ethoxybenzoyl)amino]-3-methylbutanoate.
| Compound Name | [2-(2-ethylanilino)-2-oxoethyl] 2-[(4-ethoxybenzoyl)amino]-3-methylbutanoate |
|---|---|
| PubChem CID | 55305782 |
| Molecular Formula | C24H30N2O5 |
| Molecular Weight | 426.51 g/mol |
| Exact Mass | 426.22 |
| IUPAC Name | [2-(2-ethylanilino)-2-oxoethyl] 2-[(4-ethoxybenzoyl)amino]-3-methylbutanoate |
| SMILES | CCOc1ccc(C(=O)NC(C(=O)OCC(=O)Nc2ccccc2CC)C(C)C)cc1 |
| InChI | InChI=1S/C24H30N2O5/c1-5-17-9-7-8-10-20(17)25-21(27)15-31-24(29)22(16(3)4)26-23(28)18-11-13-19(14-12-18)30-6-2/h7-14,16,22H,5-6,15H2,1-4H3,(H,25,27)(H,26,28) |
| InChIKey | NZKGPFMESJIVHZ-UHFFFAOYSA-N |
| XLogP | 3.58 |
| TPSA | 93.73 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 31 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 426.51 |
| LogP ≤ 5 | 3.58 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |