C16H22N2O4 — CID 2582740
[2-(ethylamino)-2-oxoethyl] (2S)-2-benzamido-3-methylbutanoate (PubChem CID 2582740) has the molecular formula C16H22N2O4 and a molecular weight of 306.36 g/mol. Its IUPAC name is [2-(ethylamino)-2-oxoethyl] (2S)-2-benzamido-3-methylbutanoate.
| Compound Name | [2-(ethylamino)-2-oxoethyl] (2S)-2-benzamido-3-methylbutanoate |
|---|---|
| PubChem CID | 2582740 |
| Molecular Formula | C16H22N2O4 |
| Molecular Weight | 306.36 g/mol |
| Exact Mass | 306.16 |
| IUPAC Name | [2-(ethylamino)-2-oxoethyl] (2S)-2-benzamido-3-methylbutanoate |
| SMILES | CCNC(=O)COC(=O)[C@@H](NC(=O)c1ccccc1)C(C)C |
| InChI | InChI=1S/C16H22N2O4/c1-4-17-13(19)10-22-16(21)14(11(2)3)18-15(20)12-8-6-5-7-9-12/h5-9,11,14H,4,10H2,1-3H3,(H,17,19)(H,18,20)/t14-/m0/s1 |
| InChIKey | CJXBDPACQBXXDY-AWEZNQCLSA-N |
| XLogP | 1.12 |
| TPSA | 84.50 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 306.36 |
| LogP ≤ 5 | 1.12 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |