C22H26N2O6 — CID 2583030
[2-(3,5-dimethoxyanilino)-2-oxoethyl] (2S)-2-benzamido-3-methylbutanoate (PubChem CID 2583030) has the molecular formula C22H26N2O6 and a molecular weight of 414.46 g/mol. Its IUPAC name is [2-(3,5-dimethoxyanilino)-2-oxoethyl] (2S)-2-benzamido-3-methylbutanoate.
| Compound Name | [2-(3,5-dimethoxyanilino)-2-oxoethyl] (2S)-2-benzamido-3-methylbutanoate |
|---|---|
| PubChem CID | 2583030 |
| Molecular Formula | C22H26N2O6 |
| Molecular Weight | 414.46 g/mol |
| Exact Mass | 414.18 |
| IUPAC Name | [2-(3,5-dimethoxyanilino)-2-oxoethyl] (2S)-2-benzamido-3-methylbutanoate |
| SMILES | COc1cc(NC(=O)COC(=O)[C@@H](NC(=O)c2ccccc2)C(C)C)cc(OC)c1 |
| InChI | InChI=1S/C22H26N2O6/c1-14(2)20(24-21(26)15-8-6-5-7-9-15)22(27)30-13-19(25)23-16-10-17(28-3)12-18(11-16)29-4/h5-12,14,20H,13H2,1-4H3,(H,23,25)(H,24,26)/t20-/m0/s1 |
| InChIKey | BQCZPNTVSMSJDT-FQEVSTJZSA-N |
| XLogP | 2.64 |
| TPSA | 102.96 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 414.46 |
| LogP ≤ 5 | 2.64 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |