C18H25N3O5 — CID 2582658
[2-oxo-2-(propan-2-ylcarbamoylamino)ethyl] (2R)-2-benzamido-3-methylbutanoate (PubChem CID 2582658) has the molecular formula C18H25N3O5 and a molecular weight of 363.41 g/mol. Its IUPAC name is [2-oxo-2-(propan-2-ylcarbamoylamino)ethyl] (2R)-2-benzamido-3-methylbutanoate.
| Compound Name | [2-oxo-2-(propan-2-ylcarbamoylamino)ethyl] (2R)-2-benzamido-3-methylbutanoate |
|---|---|
| PubChem CID | 2582658 |
| Molecular Formula | C18H25N3O5 |
| Molecular Weight | 363.41 g/mol |
| Exact Mass | 363.18 |
| IUPAC Name | [2-oxo-2-(propan-2-ylcarbamoylamino)ethyl] (2R)-2-benzamido-3-methylbutanoate |
| SMILES | CC(C)NC(=O)NC(=O)COC(=O)[C@H](NC(=O)c1ccccc1)C(C)C |
| InChI | InChI=1S/C18H25N3O5/c1-11(2)15(21-16(23)13-8-6-5-7-9-13)17(24)26-10-14(22)20-18(25)19-12(3)4/h5-9,11-12,15H,10H2,1-4H3,(H,21,23)(H2,19,20,22,25)/t15-/m1/s1 |
| InChIKey | VXGRKJFCEUHOGS-OAHLLOKOSA-N |
| XLogP | 1.22 |
| TPSA | 113.60 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 363.41 |
| LogP ≤ 5 | 1.22 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 5 |