C15H20N2O5 — CID 8790635
[2-oxo-2-(propan-2-ylcarbamoylamino)ethyl] (2R)-2-phenoxypropanoate (PubChem CID 8790635) has the molecular formula C15H20N2O5 and a molecular weight of 308.33 g/mol. Its IUPAC name is [2-oxo-2-(propan-2-ylcarbamoylamino)ethyl] (2R)-2-phenoxypropanoate.
| Compound Name | [2-oxo-2-(propan-2-ylcarbamoylamino)ethyl] (2R)-2-phenoxypropanoate |
|---|---|
| PubChem CID | 8790635 |
| Molecular Formula | C15H20N2O5 |
| Molecular Weight | 308.33 g/mol |
| Exact Mass | 308.14 |
| IUPAC Name | [2-oxo-2-(propan-2-ylcarbamoylamino)ethyl] (2R)-2-phenoxypropanoate |
| SMILES | CC(C)NC(=O)NC(=O)COC(=O)[C@@H](C)Oc1ccccc1 |
| InChI | InChI=1S/C15H20N2O5/c1-10(2)16-15(20)17-13(18)9-21-14(19)11(3)22-12-7-5-4-6-8-12/h4-8,10-11H,9H2,1-3H3,(H2,16,17,18,20)/t11-/m1/s1 |
| InChIKey | FEQJFXNTHIEAAX-LLVKDONJSA-N |
| XLogP | 1.23 |
| TPSA | 93.73 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 308.33 |
| LogP ≤ 5 | 1.23 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |