C14H17NO4 — CID 8791431
[2-(cyclopropylamino)-2-oxoethyl] (2S)-2-phenoxypropanoate (PubChem CID 8791431) has the molecular formula C14H17NO4 and a molecular weight of 263.29 g/mol. Its IUPAC name is [2-(cyclopropylamino)-2-oxoethyl] (2S)-2-phenoxypropanoate.
| Compound Name | [2-(cyclopropylamino)-2-oxoethyl] (2S)-2-phenoxypropanoate |
|---|---|
| PubChem CID | 8791431 |
| Molecular Formula | C14H17NO4 |
| Molecular Weight | 263.29 g/mol |
| Exact Mass | 263.12 |
| IUPAC Name | [2-(cyclopropylamino)-2-oxoethyl] (2S)-2-phenoxypropanoate |
| SMILES | C[C@H](Oc1ccccc1)C(=O)OCC(=O)NC1CC1 |
| InChI | InChI=1S/C14H17NO4/c1-10(19-12-5-3-2-4-6-12)14(17)18-9-13(16)15-11-7-8-11/h2-6,10-11H,7-9H2,1H3,(H,15,16)/t10-/m0/s1 |
| InChIKey | HXZAAWPTEVPVOU-JTQLQIEISA-N |
| XLogP | 1.28 |
| TPSA | 64.63 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 263.29 |
| LogP ≤ 5 | 1.28 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |