C14H17NO3S — CID 7806670
[2-(cyclopropylamino)-2-oxoethyl] (2R)-2-phenylsulfanylpropanoate (PubChem CID 7806670) has the molecular formula C14H17NO3S and a molecular weight of 279.36 g/mol. Its IUPAC name is [2-(cyclopropylamino)-2-oxoethyl] (2R)-2-phenylsulfanylpropanoate.
| Compound Name | [2-(cyclopropylamino)-2-oxoethyl] (2R)-2-phenylsulfanylpropanoate |
|---|---|
| PubChem CID | 7806670 |
| Molecular Formula | C14H17NO3S |
| Molecular Weight | 279.36 g/mol |
| Exact Mass | 279.09 |
| IUPAC Name | [2-(cyclopropylamino)-2-oxoethyl] (2R)-2-phenylsulfanylpropanoate |
| SMILES | C[C@@H](Sc1ccccc1)C(=O)OCC(=O)NC1CC1 |
| InChI | InChI=1S/C14H17NO3S/c1-10(19-12-5-3-2-4-6-12)14(17)18-9-13(16)15-11-7-8-11/h2-6,10-11H,7-9H2,1H3,(H,15,16)/t10-/m1/s1 |
| InChIKey | SPKHUMUZTNMGJT-SNVBAGLBSA-N |
| XLogP | 1.99 |
| TPSA | 55.40 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 279.36 |
| LogP ≤ 5 | 1.99 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |