C17H15F2NO3S — CID 7806658
[2-(2,6-difluoroanilino)-2-oxoethyl] (2R)-2-phenylsulfanylpropanoate (PubChem CID 7806658) has the molecular formula C17H15F2NO3S and a molecular weight of 351.37 g/mol. Its IUPAC name is [2-(2,6-difluoroanilino)-2-oxoethyl] (2R)-2-phenylsulfanylpropanoate.
| Compound Name | [2-(2,6-difluoroanilino)-2-oxoethyl] (2R)-2-phenylsulfanylpropanoate |
|---|---|
| PubChem CID | 7806658 |
| Molecular Formula | C17H15F2NO3S |
| Molecular Weight | 351.37 g/mol |
| Exact Mass | 351.07 |
| IUPAC Name | [2-(2,6-difluoroanilino)-2-oxoethyl] (2R)-2-phenylsulfanylpropanoate |
| SMILES | C[C@@H](Sc1ccccc1)C(=O)OCC(=O)Nc1c(F)cccc1F |
| InChI | InChI=1S/C17H15F2NO3S/c1-11(24-12-6-3-2-4-7-12)17(22)23-10-15(21)20-16-13(18)8-5-9-14(16)19/h2-9,11H,10H2,1H3,(H,20,21)/t11-/m1/s1 |
| InChIKey | QULKUWCWISBSBQ-LLVKDONJSA-N |
| XLogP | 3.63 |
| TPSA | 55.40 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 351.37 |
| LogP ≤ 5 | 3.63 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |