C18H17F2NO4S — CID 7806358
[2-[2-(difluoromethoxy)anilino]-2-oxoethyl] (2S)-2-phenylsulfanylpropanoate (PubChem CID 7806358) has the molecular formula C18H17F2NO4S and a molecular weight of 381.40 g/mol. Its IUPAC name is [2-[2-(difluoromethoxy)anilino]-2-oxoethyl] (2S)-2-phenylsulfanylpropanoate.
| Compound Name | [2-[2-(difluoromethoxy)anilino]-2-oxoethyl] (2S)-2-phenylsulfanylpropanoate |
|---|---|
| PubChem CID | 7806358 |
| Molecular Formula | C18H17F2NO4S |
| Molecular Weight | 381.40 g/mol |
| Exact Mass | 381.08 |
| IUPAC Name | [2-[2-(difluoromethoxy)anilino]-2-oxoethyl] (2S)-2-phenylsulfanylpropanoate |
| SMILES | C[C@H](Sc1ccccc1)C(=O)OCC(=O)Nc1ccccc1OC(F)F |
| InChI | InChI=1S/C18H17F2NO4S/c1-12(26-13-7-3-2-4-8-13)17(23)24-11-16(22)21-14-9-5-6-10-15(14)25-18(19)20/h2-10,12,18H,11H2,1H3,(H,21,22)/t12-/m0/s1 |
| InChIKey | LSQXAEFUSWATNV-LBPRGKRZSA-N |
| XLogP | 3.95 |
| TPSA | 64.63 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 381.40 |
| LogP ≤ 5 | 3.95 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |