C18H18ClNO3S — CID 7806673
[2-(2-chloro-4-methylanilino)-2-oxoethyl] (2R)-2-phenylsulfanylpropanoate (PubChem CID 7806673) has the molecular formula C18H18ClNO3S and a molecular weight of 363.87 g/mol. Its IUPAC name is [2-(2-chloro-4-methylanilino)-2-oxoethyl] (2R)-2-phenylsulfanylpropanoate.
| Compound Name | [2-(2-chloro-4-methylanilino)-2-oxoethyl] (2R)-2-phenylsulfanylpropanoate |
|---|---|
| PubChem CID | 7806673 |
| Molecular Formula | C18H18ClNO3S |
| Molecular Weight | 363.87 g/mol |
| Exact Mass | 363.07 |
| IUPAC Name | [2-(2-chloro-4-methylanilino)-2-oxoethyl] (2R)-2-phenylsulfanylpropanoate |
| SMILES | Cc1ccc(NC(=O)COC(=O)[C@@H](C)Sc2ccccc2)c(Cl)c1 |
| InChI | InChI=1S/C18H18ClNO3S/c1-12-8-9-16(15(19)10-12)20-17(21)11-23-18(22)13(2)24-14-6-4-3-5-7-14/h3-10,13H,11H2,1-2H3,(H,20,21)/t13-/m1/s1 |
| InChIKey | DMGCXPSIFVCOIW-CYBMUJFWSA-N |
| XLogP | 4.31 |
| TPSA | 55.40 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 363.87 |
| LogP ≤ 5 | 4.31 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |