C17H15F2NO5 — CID 7821391
[2-[2-(difluoromethoxy)anilino]-2-oxoethyl] (2S)-2-hydroxy-2-phenylacetate (PubChem CID 7821391) has the molecular formula C17H15F2NO5 and a molecular weight of 351.31 g/mol. Its IUPAC name is [2-[2-(difluoromethoxy)anilino]-2-oxoethyl] (2S)-2-hydroxy-2-phenylacetate.
| Compound Name | [2-[2-(difluoromethoxy)anilino]-2-oxoethyl] (2S)-2-hydroxy-2-phenylacetate |
|---|---|
| PubChem CID | 7821391 |
| Molecular Formula | C17H15F2NO5 |
| Molecular Weight | 351.31 g/mol |
| Exact Mass | 351.09 |
| IUPAC Name | [2-[2-(difluoromethoxy)anilino]-2-oxoethyl] (2S)-2-hydroxy-2-phenylacetate |
| SMILES | O=C(COC(=O)[C@@H](O)c1ccccc1)Nc1ccccc1OC(F)F |
| InChI | InChI=1S/C17H15F2NO5/c18-17(19)25-13-9-5-4-8-12(13)20-14(21)10-24-16(23)15(22)11-6-2-1-3-7-11/h1-9,15,17,22H,10H2,(H,20,21)/t15-/m0/s1 |
| InChIKey | RDKSWRZMGYAXQH-HNNXBMFYSA-N |
| XLogP | 2.50 |
| TPSA | 84.86 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 351.31 |
| LogP ≤ 5 | 2.50 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |