C17H17F2NO4 — CID 7941491
N-[2-(difluoromethoxy)phenyl]-2-(2-ethoxyphenoxy)acetamide (PubChem CID 7941491) has the molecular formula C17H17F2NO4 and a molecular weight of 337.32 g/mol. Its IUPAC name is N-[2-(difluoromethoxy)phenyl]-2-(2-ethoxyphenoxy)acetamide.
| Compound Name | N-[2-(difluoromethoxy)phenyl]-2-(2-ethoxyphenoxy)acetamide |
|---|---|
| PubChem CID | 7941491 |
| Molecular Formula | C17H17F2NO4 |
| Molecular Weight | 337.32 g/mol |
| Exact Mass | 337.11 |
| IUPAC Name | N-[2-(difluoromethoxy)phenyl]-2-(2-ethoxyphenoxy)acetamide |
| SMILES | CCOc1ccccc1OCC(=O)Nc1ccccc1OC(F)F |
| InChI | InChI=1S/C17H17F2NO4/c1-2-22-14-9-5-6-10-15(14)23-11-16(21)20-12-7-3-4-8-13(12)24-17(18)19/h3-10,17H,2,11H2,1H3,(H,20,21) |
| InChIKey | KYXJNIVIOYWAQQ-UHFFFAOYSA-N |
| XLogP | 3.70 |
| TPSA | 56.79 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 337.32 |
| LogP ≤ 5 | 3.70 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |