C16H14F2N2O4 — CID 7278808
2-[2-[2-(difluoromethoxy)anilino]-2-oxoethoxy]benzamide (PubChem CID 7278808) has the molecular formula C16H14F2N2O4 and a molecular weight of 336.29 g/mol. Its IUPAC name is 2-[2-[2-(difluoromethoxy)anilino]-2-oxoethoxy]benzamide.
| Compound Name | 2-[2-[2-(difluoromethoxy)anilino]-2-oxoethoxy]benzamide |
|---|---|
| PubChem CID | 7278808 |
| Molecular Formula | C16H14F2N2O4 |
| Molecular Weight | 336.29 g/mol |
| Exact Mass | 336.09 |
| IUPAC Name | 2-[2-[2-(difluoromethoxy)anilino]-2-oxoethoxy]benzamide |
| SMILES | NC(=O)c1ccccc1OCC(=O)Nc1ccccc1OC(F)F |
| InChI | InChI=1S/C16H14F2N2O4/c17-16(18)24-13-8-4-2-6-11(13)20-14(21)9-23-12-7-3-1-5-10(12)15(19)22/h1-8,16H,9H2,(H2,19,22)(H,20,21) |
| InChIKey | ATAVBIWROKUGGG-UHFFFAOYSA-N |
| XLogP | 2.40 |
| TPSA | 90.65 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 336.29 |
| LogP ≤ 5 | 2.40 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |