C17H13F2N3O3 — CID 2392933
N-[2-(difluoromethoxy)phenyl]-2-quinazolin-4-yloxyacetamide (PubChem CID 2392933) has the molecular formula C17H13F2N3O3 and a molecular weight of 345.31 g/mol. Its IUPAC name is N-[2-(difluoromethoxy)phenyl]-2-quinazolin-4-yloxyacetamide.
| Compound Name | N-[2-(difluoromethoxy)phenyl]-2-quinazolin-4-yloxyacetamide |
|---|---|
| PubChem CID | 2392933 |
| Molecular Formula | C17H13F2N3O3 |
| Molecular Weight | 345.31 g/mol |
| Exact Mass | 345.09 |
| IUPAC Name | N-[2-(difluoromethoxy)phenyl]-2-quinazolin-4-yloxyacetamide |
| SMILES | O=C(COc1ncnc2ccccc12)Nc1ccccc1OC(F)F |
| InChI | InChI=1S/C17H13F2N3O3/c18-17(19)25-14-8-4-3-7-13(14)22-15(23)9-24-16-11-5-1-2-6-12(11)20-10-21-16/h1-8,10,17H,9H2,(H,22,23) |
| InChIKey | QCXFHAAQSPYIDB-UHFFFAOYSA-N |
| XLogP | 3.25 |
| TPSA | 73.34 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 345.31 |
| LogP ≤ 5 | 3.25 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |