C13H13F2NO4 — CID 2510947
[2-[2-(difluoromethoxy)anilino]-2-oxoethyl] cyclopropanecarboxylate (PubChem CID 2510947) has the molecular formula C13H13F2NO4 and a molecular weight of 285.25 g/mol. Its IUPAC name is [2-[2-(difluoromethoxy)anilino]-2-oxoethyl] cyclopropanecarboxylate.
| Compound Name | [2-[2-(difluoromethoxy)anilino]-2-oxoethyl] cyclopropanecarboxylate |
|---|---|
| PubChem CID | 2510947 |
| Molecular Formula | C13H13F2NO4 |
| Molecular Weight | 285.25 g/mol |
| Exact Mass | 285.08 |
| IUPAC Name | [2-[2-(difluoromethoxy)anilino]-2-oxoethyl] cyclopropanecarboxylate |
| SMILES | O=C(COC(=O)C1CC1)Nc1ccccc1OC(F)F |
| InChI | InChI=1S/C13H13F2NO4/c14-13(15)20-10-4-2-1-3-9(10)16-11(17)7-19-12(18)8-5-6-8/h1-4,8,13H,5-7H2,(H,16,17) |
| InChIKey | JGFONVCFLMPPSA-UHFFFAOYSA-N |
| XLogP | 2.18 |
| TPSA | 64.63 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 285.25 |
| LogP ≤ 5 | 2.18 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |