C15H19F2NO2 — CID 112793238
2-cyclohexyl-N-[2-(difluoromethoxy)phenyl]acetamide (PubChem CID 112793238) has the molecular formula C15H19F2NO2 and a molecular weight of 283.32 g/mol. Its IUPAC name is 2-cyclohexyl-N-[2-(difluoromethoxy)phenyl]acetamide.
| Compound Name | 2-cyclohexyl-N-[2-(difluoromethoxy)phenyl]acetamide |
|---|---|
| PubChem CID | 112793238 |
| Molecular Formula | C15H19F2NO2 |
| Molecular Weight | 283.32 g/mol |
| Exact Mass | 283.14 |
| IUPAC Name | 2-cyclohexyl-N-[2-(difluoromethoxy)phenyl]acetamide |
| SMILES | O=C(CC1CCCCC1)Nc1ccccc1OC(F)F |
| InChI | InChI=1S/C15H19F2NO2/c16-15(17)20-13-9-5-4-8-12(13)18-14(19)10-11-6-2-1-3-7-11/h4-5,8-9,11,15H,1-3,6-7,10H2,(H,18,19) |
| InChIKey | KRGPAVPVXSQCRF-UHFFFAOYSA-N |
| XLogP | 4.20 |
| TPSA | 38.33 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 283.32 |
| LogP ≤ 5 | 4.20 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |