C14H16F2N2O4 — CID 119910424
(2S)-1-[2-[2-(difluoromethoxy)anilino]-2-oxoethyl]pyrrolidine-2-carboxylic acid (PubChem CID 119910424) has the molecular formula C14H16F2N2O4 and a molecular weight of 314.29 g/mol. Its IUPAC name is (2S)-1-[2-[2-(difluoromethoxy)anilino]-2-oxoethyl]pyrrolidine-2-carboxylic acid.
| Compound Name | (2S)-1-[2-[2-(difluoromethoxy)anilino]-2-oxoethyl]pyrrolidine-2-carboxylic acid |
|---|---|
| PubChem CID | 119910424 |
| Molecular Formula | C14H16F2N2O4 |
| Molecular Weight | 314.29 g/mol |
| Exact Mass | 314.11 |
| IUPAC Name | (2S)-1-[2-[2-(difluoromethoxy)anilino]-2-oxoethyl]pyrrolidine-2-carboxylic acid |
| SMILES | O=C(CN1CCC[C@H]1C(=O)O)Nc1ccccc1OC(F)F |
| InChI | InChI=1S/C14H16F2N2O4/c15-14(16)22-11-6-2-1-4-9(11)17-12(19)8-18-7-3-5-10(18)13(20)21/h1-2,4,6,10,14H,3,5,7-8H2,(H,17,19)(H,20,21)/t10-/m0/s1 |
| InChIKey | WATREFHECXCZRX-JTQLQIEISA-N |
| XLogP | 1.78 |
| TPSA | 78.87 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 314.29 |
| LogP ≤ 5 | 1.78 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |