C17H21N3O4 — CID 119909357
1-[2-oxo-2-[2-(2-oxopyrrolidin-1-yl)anilino]ethyl]pyrrolidine-2-carboxylic acid (PubChem CID 119909357) has the molecular formula C17H21N3O4 and a molecular weight of 331.37 g/mol. Its IUPAC name is 1-[2-oxo-2-[2-(2-oxopyrrolidin-1-yl)anilino]ethyl]pyrrolidine-2-carboxylic acid.
| Compound Name | 1-[2-oxo-2-[2-(2-oxopyrrolidin-1-yl)anilino]ethyl]pyrrolidine-2-carboxylic acid |
|---|---|
| PubChem CID | 119909357 |
| Molecular Formula | C17H21N3O4 |
| Molecular Weight | 331.37 g/mol |
| Exact Mass | 331.15 |
| IUPAC Name | 1-[2-oxo-2-[2-(2-oxopyrrolidin-1-yl)anilino]ethyl]pyrrolidine-2-carboxylic acid |
| SMILES | O=C(CN1CCCC1C(=O)O)Nc1ccccc1N1CCCC1=O |
| InChI | InChI=1S/C17H21N3O4/c21-15(11-19-9-3-7-14(19)17(23)24)18-12-5-1-2-6-13(12)20-10-4-8-16(20)22/h1-2,5-6,14H,3-4,7-11H2,(H,18,21)(H,23,24) |
| InChIKey | SMLUIDNBHWRRAZ-UHFFFAOYSA-N |
| XLogP | 1.30 |
| TPSA | 89.95 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 331.37 |
| LogP ≤ 5 | 1.30 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |