C17H23N3O3 — CID 41335965
2-(4-hydroxypiperidin-1-yl)-N-[2-(2-oxopyrrolidin-1-yl)phenyl]acetamide (PubChem CID 41335965) has the molecular formula C17H23N3O3 and a molecular weight of 317.39 g/mol. Its IUPAC name is 2-(4-hydroxypiperidin-1-yl)-N-[2-(2-oxopyrrolidin-1-yl)phenyl]acetamide.
| Compound Name | 2-(4-hydroxypiperidin-1-yl)-N-[2-(2-oxopyrrolidin-1-yl)phenyl]acetamide |
|---|---|
| PubChem CID | 41335965 |
| Molecular Formula | C17H23N3O3 |
| Molecular Weight | 317.39 g/mol |
| Exact Mass | 317.17 |
| IUPAC Name | 2-(4-hydroxypiperidin-1-yl)-N-[2-(2-oxopyrrolidin-1-yl)phenyl]acetamide |
| SMILES | O=C(CN1CCC(O)CC1)Nc1ccccc1N1CCCC1=O |
| InChI | InChI=1S/C17H23N3O3/c21-13-7-10-19(11-8-13)12-16(22)18-14-4-1-2-5-15(14)20-9-3-6-17(20)23/h1-2,4-5,13,21H,3,6-12H2,(H,18,22) |
| InChIKey | AHZZFKFSASEHDJ-UHFFFAOYSA-N |
| XLogP | 1.21 |
| TPSA | 72.88 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 317.39 |
| LogP ≤ 5 | 1.21 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |